About 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one
6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one (PubChem CID 156889018) has the molecular formula C16H13N5O
and a molecular weight of 291.31 g/mol. Its IUPAC name is 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one.
Molecular Properties
| Compound Name | 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one |
| PubChem CID | 156889018 |
| Molecular Formula | C16H13N5O |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one |
| SMILES | Cc1cn2nc(-c3ccc4c(=O)[nH]ncc4c3)cc(C)c2n1 |
| InChI | InChI=1S/C16H13N5O/c1-9-5-14(20-21-8-10(2)18-15(9)21)11-3-4-13-12(6-11)7-17-19-16(13)22/h3-8H,1-2H3,(H,19,22) |
| InChIKey | GMMHBYCDBJQEMX-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 75.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one?
The IUPAC name of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one (CID 156889018) is 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one.
What is the SMILES notation for 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one?
The canonical SMILES for 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one is Cc1cn2nc(-c3ccc4c(=O)[nH]ncc4c3)cc(C)c2n1.
What is the InChIKey of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one?
The InChIKey is GMMHBYCDBJQEMX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O/c1-9-5-14(20-21-8-10(2)18-15(9)21)11-3-4-13-12(6-11)7-17-19-16(13)22/h3-8H,1-2H3,(H,19,22).
What are the key properties of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one?
6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one has a molecular weight of 291.31 g/mol, XLogP of 2.25, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one is sourced from PubChem (CID 156889018), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).