About 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine
6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine (PubChem CID 156889311) has the molecular formula C23H30N6O
and a molecular weight of 406.53 g/mol. Its IUPAC name is 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine.
Molecular Properties
| Compound Name | 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine |
| PubChem CID | 156889311 |
| Molecular Formula | C23H30N6O |
| Molecular Weight | 406.53 g/mol |
| Exact Mass | 406.25 |
| IUPAC Name | 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine |
| SMILES | C1CCNCC1.CC.Cc1cn2nc(-c3ccc4c(=O)[nH]ncc4c3)cc(C)c2n1 |
| InChI | InChI=1S/C16H13N5O.C5H11N.C2H6/c1-9-5-14(20-21-8-10(2)18-15(9)21)11-3-4-13-12(6-11)7-17-19-16(13)22;1-2-4-6-5-3-1;1-2/h3-8H,1-2H3,(H,19,22);6H,1-5H2;1-2H3 |
| InChIKey | ACMUBESWNNBLQP-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 87.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 406.53 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine?
The IUPAC name of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine (CID 156889311) is 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine.
What is the SMILES notation for 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine?
The canonical SMILES for 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine is C1CCNCC1.CC.Cc1cn2nc(-c3ccc4c(=O)[nH]ncc4c3)cc(C)c2n1.
What is the InChIKey of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine?
The InChIKey is ACMUBESWNNBLQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13N5O.C5H11N.C2H6/c1-9-5-14(20-21-8-10(2)18-15(9)21)11-3-4-13-12(6-11)7-17-19-16(13)22;1-2-4-6-5-3-1;1-2/h3-8H,1-2H3,(H,19,22);6H,1-5H2;1-2H3.
What are the key properties of 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine?
6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine has a molecular weight of 406.53 g/mol, XLogP of 4.04, 1 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-(2,8-dimethylimidazo[1,2-b]pyridazin-6-yl)-2H-phthalazin-1-one;ethane;piperidine is sourced from PubChem (CID 156889311), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).