About 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine
2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine (PubChem CID 156889905) has the molecular formula C13H29N3O
and a molecular weight of 243.39 g/mol. Its IUPAC name is 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine.
Molecular Properties
| Compound Name | 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine |
| PubChem CID | 156889905 |
| Molecular Formula | C13H29N3O |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.23 |
| IUPAC Name | 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine |
| SMILES | CC1(C)CNCCN1.CCC1(C)CNCCO1 |
| InChI | InChI=1S/C7H15NO.C6H14N2/c1-3-7(2)6-8-4-5-9-7;1-6(2)5-7-3-4-8-6/h8H,3-6H2,1-2H3;7-8H,3-5H2,1-2H3 |
| InChIKey | LLEPNLTVGPHNGL-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 45.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine?
The IUPAC name of 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine (CID 156889905) is 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine.
What is the SMILES notation for 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine?
The canonical SMILES for 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine is CC1(C)CNCCN1.CCC1(C)CNCCO1.
What is the InChIKey of 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine?
The InChIKey is LLEPNLTVGPHNGL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO.C6H14N2/c1-3-7(2)6-8-4-5-9-7;1-6(2)5-7-3-4-8-6/h8H,3-6H2,1-2H3;7-8H,3-5H2,1-2H3.
What are the key properties of 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine?
2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine has a molecular weight of 243.39 g/mol, XLogP of 0.73, 1 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-dimethylpiperazine;2-ethyl-2-methylmorpholine is sourced from PubChem (CID 156889905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).