About methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate
methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate (PubChem CID 156889989) has the molecular formula C11H8BrF3N2O2
and a molecular weight of 337.10 g/mol. Its IUPAC name is methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate.
Molecular Properties
| Compound Name | methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate |
| PubChem CID | 156889989 |
| Molecular Formula | C11H8BrF3N2O2 |
| Molecular Weight | 337.10 g/mol |
| Exact Mass | 335.97 |
| IUPAC Name | methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate |
| SMILES | COC(=O)c1cc(Br)cc2nn(CC(F)(F)F)cc12 |
| InChI | InChI=1S/C11H8BrF3N2O2/c1-19-10(18)7-2-6(12)3-9-8(7)4-17(16-9)5-11(13,14)15/h2-4H,5H2,1H3 |
| InChIKey | YODCZPVPVZQJFM-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 44.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.10 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate?
The IUPAC name of methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate (CID 156889989) is methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate.
What is the SMILES notation for methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate?
The canonical SMILES for methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate is COC(=O)c1cc(Br)cc2nn(CC(F)(F)F)cc12.
What is the InChIKey of methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate?
The InChIKey is YODCZPVPVZQJFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrF3N2O2/c1-19-10(18)7-2-6(12)3-9-8(7)4-17(16-9)5-11(13,14)15/h2-4H,5H2,1H3.
What are the key properties of methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate?
methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate has a molecular weight of 337.10 g/mol, XLogP of 3.15, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-bromo-2-(2,2,2-trifluoroethyl)indazole-4-carboxylate is sourced from PubChem (CID 156889989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).