About ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one
ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one (PubChem CID 156890371) has the molecular formula C8H14F2O2
and a molecular weight of 180.19 g/mol. Its IUPAC name is ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one.
Molecular Properties
| Compound Name | ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one |
| PubChem CID | 156890371 |
| Molecular Formula | C8H14F2O2 |
| Molecular Weight | 180.19 g/mol |
| Exact Mass | 180.10 |
| IUPAC Name | ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one |
| SMILES | CC.CCO/C=C/C(=O)C(F)F |
| InChI | InChI=1S/C6H8F2O2.C2H6/c1-2-10-4-3-5(9)6(7)8;1-2/h3-4,6H,2H2,1H3;1-2H3/b4-3+; |
| InChIKey | KCHDDPZBPDEYGT-BJILWQEISA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.19 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one?
The IUPAC name of ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one (CID 156890371) is ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one.
What is the SMILES notation for ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one?
The canonical SMILES for ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one is CC.CCO/C=C/C(=O)C(F)F.
What is the InChIKey of ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one?
The InChIKey is KCHDDPZBPDEYGT-BJILWQEISA-N. The full InChI is InChI=1S/C6H8F2O2.C2H6/c1-2-10-4-3-5(9)6(7)8;1-2/h3-4,6H,2H2,1H3;1-2H3/b4-3+;.
What are the key properties of ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one?
ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one has a molecular weight of 180.19 g/mol, XLogP of 2.40, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;(E)-4-ethoxy-1,1-difluorobut-3-en-2-one is sourced from PubChem (CID 156890371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).