C19H23BN4O2 — CID 156891382
3-[(4-cyclopropyltriazol-1-yl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile (PubChem CID 156891382) has the molecular formula C19H23BN4O2 and a molecular weight of 350.23 g/mol. Its IUPAC name is 3-[(4-cyclopropyltriazol-1-yl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile.
| Compound Name | 3-[(4-cyclopropyltriazol-1-yl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
|---|---|
| PubChem CID | 156891382 |
| Molecular Formula | C19H23BN4O2 |
| Molecular Weight | 350.23 g/mol |
| Exact Mass | 350.19 |
| IUPAC Name | 3-[(4-cyclopropyltriazol-1-yl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzonitrile |
| SMILES | CC1(C)OB(c2ccc(C#N)cc2Cn2cc(C3CC3)nn2)OC1(C)C |
| InChI | InChI=1S/C19H23BN4O2/c1-18(2)19(3,4)26-20(25-18)16-8-5-13(10-21)9-15(16)11-24-12-17(22-23-24)14-6-7-14/h5,8-9,12,14H,6-7,11H2,1-4H3 |
| InChIKey | CJKXODJUPIDURX-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 72.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.23 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|