C38H35F3N4O2Si — CID 156891923
3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-8-pyridin-3-yl-6-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyrimidin-4-one (PubChem CID 156891923) has the molecular formula C38H35F3N4O2Si and a molecular weight of 664.80 g/mol. Its IUPAC name is 3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-8-pyridin-3-yl-6-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-8-pyridin-3-yl-6-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 156891923 |
| Molecular Formula | C38H35F3N4O2Si |
| Molecular Weight | 664.80 g/mol |
| Exact Mass | 664.25 |
| IUPAC Name | 3-[1-[tert-butyl(diphenyl)silyl]oxypropan-2-yl]-8-pyridin-3-yl-6-[4-(trifluoromethyl)phenyl]pyrido[3,4-d]pyrimidin-4-one |
| SMILES | CC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)n1cnc2c(-c3cccnc3)nc(-c3ccc(C(F)(F)F)cc3)cc2c1=O |
| InChI | InChI=1S/C38H35F3N4O2Si/c1-26(24-47-48(37(2,3)4,30-13-7-5-8-14-30)31-15-9-6-10-16-31)45-25-43-35-32(36(45)46)22-33(44-34(35)28-12-11-21-42-23-28)27-17-19-29(20-18-27)38(39,40)41/h5-23,25-26H,24H2,1-4H3 |
| InChIKey | NLTNUPFIDWVVPY-UHFFFAOYSA-N |
| XLogP | 7.68 |
| TPSA | 69.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 664.80 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|