About methanethiol;methyl 2-(oxolan-3-ylamino)acetate
methanethiol;methyl 2-(oxolan-3-ylamino)acetate (PubChem CID 156892009) has the molecular formula C8H17NO3S
and a molecular weight of 207.29 g/mol. Its IUPAC name is methanethiol;methyl 2-(oxolan-3-ylamino)acetate.
Molecular Properties
| Compound Name | methanethiol;methyl 2-(oxolan-3-ylamino)acetate |
| PubChem CID | 156892009 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | methanethiol;methyl 2-(oxolan-3-ylamino)acetate |
| SMILES | COC(=O)CNC1CCOC1.CS |
| InChI | InChI=1S/C7H13NO3.CH4S/c1-10-7(9)4-8-6-2-3-11-5-6;1-2/h6,8H,2-5H2,1H3;2H,1H3 |
| InChIKey | JRUHWDPDSDGCIE-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze methanethiol;methyl 2-(oxolan-3-ylamino)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanethiol;methyl 2-(oxolan-3-ylamino)acetate?
The IUPAC name of methanethiol;methyl 2-(oxolan-3-ylamino)acetate (CID 156892009) is methanethiol;methyl 2-(oxolan-3-ylamino)acetate.
What is the SMILES notation for methanethiol;methyl 2-(oxolan-3-ylamino)acetate?
The canonical SMILES for methanethiol;methyl 2-(oxolan-3-ylamino)acetate is COC(=O)CNC1CCOC1.CS.
What is the InChIKey of methanethiol;methyl 2-(oxolan-3-ylamino)acetate?
The InChIKey is JRUHWDPDSDGCIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO3.CH4S/c1-10-7(9)4-8-6-2-3-11-5-6;1-2/h6,8H,2-5H2,1H3;2H,1H3.
What are the key properties of methanethiol;methyl 2-(oxolan-3-ylamino)acetate?
methanethiol;methyl 2-(oxolan-3-ylamino)acetate has a molecular weight of 207.29 g/mol, XLogP of 0.08, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methanethiol;methyl 2-(oxolan-3-ylamino)acetate is sourced from PubChem (CID 156892009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).