About ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one
ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one (PubChem CID 156893057) has the molecular formula C9H19N3O
and a molecular weight of 185.27 g/mol. Its IUPAC name is ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one.
Molecular Properties
| Compound Name | ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one |
| PubChem CID | 156893057 |
| Molecular Formula | C9H19N3O |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.15 |
| IUPAC Name | ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one |
| SMILES | CC.[H]/N=C1/C(C)N(CC)C(=O)N1C |
| InChI | InChI=1S/C7H13N3O.C2H6/c1-4-10-5(2)6(8)9(3)7(10)11;1-2/h5,8H,4H2,1-3H3;1-2H3/b8-6-; |
| InChIKey | KEYZWRUDWVUYEU-PHZXCRFESA-N |
| XLogP | 1.77 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one?
The IUPAC name of ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one (CID 156893057) is ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one.
What is the SMILES notation for ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one?
The canonical SMILES for ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one is CC.[H]/N=C1/C(C)N(CC)C(=O)N1C.
What is the InChIKey of ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one?
The InChIKey is KEYZWRUDWVUYEU-PHZXCRFESA-N. The full InChI is InChI=1S/C7H13N3O.C2H6/c1-4-10-5(2)6(8)9(3)7(10)11;1-2/h5,8H,4H2,1-3H3;1-2H3/b8-6-;.
What are the key properties of ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one?
ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one has a molecular weight of 185.27 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;1-ethyl-4-imino-3,5-dimethylimidazolidin-2-one is sourced from PubChem (CID 156893057), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).