C15H24N2O — CID 156893345
ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile (PubChem CID 156893345) has the molecular formula C15H24N2O and a molecular weight of 248.37 g/mol. Its IUPAC name is ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile.
| Compound Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 156893345 |
| Molecular Formula | C15H24N2O |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.19 |
| IUPAC Name | ethane;4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile |
| SMILES | C=C/C=C(\C=C/C)OC1CC(C)N(C#N)C1.CC |
| InChI | InChI=1S/C13H18N2O.C2H6/c1-4-6-12(7-5-2)16-13-8-11(3)15(9-13)10-14;1-2/h4-7,11,13H,1,8-9H2,2-3H3;1-2H3/b7-5-,12-6+; |
| InChIKey | AXDTZYMPBHNQHJ-AOMYCQKGSA-N |
| XLogP | 3.62 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|