C13H18N2O — CID 156893346
4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile (PubChem CID 156893346) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile.
| Compound Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile |
|---|---|
| PubChem CID | 156893346 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-[(3E,5Z)-hepta-1,3,5-trien-4-yl]oxy-2-methylpyrrolidine-1-carbonitrile |
| SMILES | C=C/C=C(\C=C/C)OC1CC(C)N(C#N)C1 |
| InChI | InChI=1S/C13H18N2O/c1-4-6-12(7-5-2)16-13-8-11(3)15(9-13)10-14/h4-7,11,13H,1,8-9H2,2-3H3/b7-5-,12-6+ |
| InChIKey | FLDYXVRCLPMHSA-NFWBANDSSA-N |
| XLogP | 2.59 |
| TPSA | 36.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|