C16H19NO5S — CID 15689374
ethyl 2-[(3S,4R)-3-acetyloxy-4-prop-2-enyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate (PubChem CID 15689374) has the molecular formula C16H19NO5S and a molecular weight of 337.40 g/mol. Its IUPAC name is ethyl 2-[(3S,4R)-3-acetyloxy-4-prop-2-enyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(3S,4R)-3-acetyloxy-4-prop-2-enyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 15689374 |
| Molecular Formula | C16H19NO5S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | ethyl 2-[(3S,4R)-3-acetyloxy-4-prop-2-enyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate |
| SMILES | C=CC[C@@H]1C=C(c2nc(C(=O)OCC)cs2)OC[C@H]1OC(C)=O |
| InChI | InChI=1S/C16H19NO5S/c1-4-6-11-7-13(21-8-14(11)22-10(3)18)15-17-12(9-23-15)16(19)20-5-2/h4,7,9,11,14H,1,5-6,8H2,2-3H3/t11-,14-/m1/s1 |
| InChIKey | VKJKBEJCHDDDEJ-BXUZGUMPSA-N |
| XLogP | 2.81 |
| TPSA | 74.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|