C27H33NO14S2 — CID 15689375
ethyl 2-[(3R,4R)-3-acetyloxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate (PubChem CID 15689375) has the molecular formula C27H33NO14S2 and a molecular weight of 659.69 g/mol. Its IUPAC name is ethyl 2-[(3R,4R)-3-acetyloxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate.
| Compound Name | ethyl 2-[(3R,4R)-3-acetyloxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate |
|---|---|
| PubChem CID | 15689375 |
| Molecular Formula | C27H33NO14S2 |
| Molecular Weight | 659.69 g/mol |
| Exact Mass | 659.13 |
| IUPAC Name | ethyl 2-[(3R,4R)-3-acetyloxy-4-[(2S,3R,4S,5R,6R)-3,4,5-triacetyloxy-6-(acetyloxymethyl)oxan-2-yl]sulfanyl-3,4-dihydro-2H-pyran-6-yl]-1,3-thiazole-4-carboxylate |
| SMILES | CCOC(=O)c1csc(C2=C[C@@H](S[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H]3OC(C)=O)[C@H](OC(C)=O)CO2)n1 |
| InChI | InChI=1S/C27H33NO14S2/c1-7-35-26(34)17-11-43-25(28-17)18-8-21(19(9-37-18)38-13(3)30)44-27-24(41-16(6)33)23(40-15(5)32)22(39-14(4)31)20(42-27)10-36-12(2)29/h8,11,19-24,27H,7,9-10H2,1-6H3/t19-,20-,21-,22-,23+,24-,27+/m1/s1 |
| InChIKey | WQJHYFQKIDONEK-CCBIAVSUSA-N |
| XLogP | 1.81 |
| TPSA | 189.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 659.69 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|