About ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one
ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one (PubChem CID 156894013) has the molecular formula C14H31N3O
and a molecular weight of 257.42 g/mol. Its IUPAC name is ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one.
Molecular Properties
| Compound Name | ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one |
| PubChem CID | 156894013 |
| Molecular Formula | C14H31N3O |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.25 |
| IUPAC Name | ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one |
| SMILES | CC.CC.[H]/N=C1\C(C)N(CCC)C(=O)N1CCC |
| InChI | InChI=1S/C10H19N3O.2C2H6/c1-4-6-12-8(3)9(11)13(7-5-2)10(12)14;2*1-2/h8,11H,4-7H2,1-3H3;2*1-2H3/b11-9+;; |
| InChIKey | LXOGIZOVDUCBIS-OTBYXNOXSA-N |
| XLogP | 3.96 |
| TPSA | 47.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one?
The IUPAC name of ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one (CID 156894013) is ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one.
What is the SMILES notation for ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one?
The canonical SMILES for ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one is CC.CC.[H]/N=C1\C(C)N(CCC)C(=O)N1CCC.
What is the InChIKey of ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one?
The InChIKey is LXOGIZOVDUCBIS-OTBYXNOXSA-N. The full InChI is InChI=1S/C10H19N3O.2C2H6/c1-4-6-12-8(3)9(11)13(7-5-2)10(12)14;2*1-2/h8,11H,4-7H2,1-3H3;2*1-2H3/b11-9+;;.
What are the key properties of ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one?
ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one has a molecular weight of 257.42 g/mol, XLogP of 3.96, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-imino-5-methyl-1,3-dipropylimidazolidin-2-one is sourced from PubChem (CID 156894013), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).