C27H40N4O3 — CID 156894299
(Z,3E)-2-(4-tert-butyl-N-methylanilino)-N-cyclopropyl-3-[(methylideneamino)methylidene]hex-4-enamide;4-hydroxypyrrolidine-2-carbaldehyde (PubChem CID 156894299) has the molecular formula C27H40N4O3 and a molecular weight of 468.64 g/mol. Its IUPAC name is (Z,3E)-2-(4-tert-butyl-N-methylanilino)-N-cyclopropyl-3-[(methylideneamino)methylidene]hex-4-enamide;4-hydroxypyrrolidine-2-carbaldehyde.
| Compound Name | (Z,3E)-2-(4-tert-butyl-N-methylanilino)-N-cyclopropyl-3-[(methylideneamino)methylidene]hex-4-enamide;4-hydroxypyrrolidine-2-carbaldehyde |
|---|---|
| PubChem CID | 156894299 |
| Molecular Formula | C27H40N4O3 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.31 |
| IUPAC Name | (Z,3E)-2-(4-tert-butyl-N-methylanilino)-N-cyclopropyl-3-[(methylideneamino)methylidene]hex-4-enamide;4-hydroxypyrrolidine-2-carbaldehyde |
| SMILES | C=N/C=C(\C=C/C)C(C(=O)NC1CC1)N(C)c1ccc(C(C)(C)C)cc1.O=CC1CC(O)CN1 |
| InChI | InChI=1S/C22H31N3O.C5H9NO2/c1-7-8-16(15-23-5)20(21(26)24-18-11-12-18)25(6)19-13-9-17(10-14-19)22(2,3)4;7-3-4-1-5(8)2-6-4/h7-10,13-15,18,20H,5,11-12H2,1-4,6H3,(H,24,26);3-6,8H,1-2H2/b8-7-,16-15+; |
| InChIKey | ITMHUXHHGBLOHI-MEWFARHVSA-N |
| XLogP | 3.14 |
| TPSA | 94.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|