C26H25F8N5O3S — CID 156894426
1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(5-fluoro-3-pyridinyl)-2-oxoethyl]-4-oxo-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-3-carboxamide (PubChem CID 156894426) has the molecular formula C26H25F8N5O3S and a molecular weight of 639.57 g/mol. Its IUPAC name is 1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(5-fluoro-3-pyridinyl)-2-oxoethyl]-4-oxo-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-3-carboxamide.
| Compound Name | 1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(5-fluoro-3-pyridinyl)-2-oxoethyl]-4-oxo-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 156894426 |
| Molecular Formula | C26H25F8N5O3S |
| Molecular Weight | 639.57 g/mol |
| Exact Mass | 639.16 |
| IUPAC Name | 1-cyano-N-[2-[(4,4-difluorocyclohexyl)amino]-1-(5-fluoro-3-pyridinyl)-2-oxoethyl]-4-oxo-N-[4-(pentafluoro-λ6-sulfanyl)phenyl]piperidine-3-carboxamide |
| SMILES | N#CN1CCC(=O)C(C(=O)N(c2ccc(S(F)(F)(F)(F)F)cc2)C(C(=O)NC2CCC(F)(F)CC2)c2cncc(F)c2)C1 |
| InChI | InChI=1S/C26H25F8N5O3S/c27-17-11-16(12-36-13-17)23(24(41)37-18-5-8-26(28,29)9-6-18)39(25(42)21-14-38(15-35)10-7-22(21)40)19-1-3-20(4-2-19)43(30,31,32,33)34/h1-4,11-13,18,21,23H,5-10,14H2,(H,37,41) |
| InChIKey | PNMKQBRXXDTJRF-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 106.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 639.57 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|