C14H12BrF5O — CID 156894779
(2R)-8-bromo-3,3,4,4,7-pentafluoro-1-methyl-2-prop-2-enyl-1H-naphthalen-2-ol (PubChem CID 156894779) has the molecular formula C14H12BrF5O and a molecular weight of 371.14 g/mol. Its IUPAC name is (2R)-8-bromo-3,3,4,4,7-pentafluoro-1-methyl-2-prop-2-enyl-1H-naphthalen-2-ol.
| Compound Name | (2R)-8-bromo-3,3,4,4,7-pentafluoro-1-methyl-2-prop-2-enyl-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 156894779 |
| Molecular Formula | C14H12BrF5O |
| Molecular Weight | 371.14 g/mol |
| Exact Mass | 370.00 |
| IUPAC Name | (2R)-8-bromo-3,3,4,4,7-pentafluoro-1-methyl-2-prop-2-enyl-1H-naphthalen-2-ol |
| SMILES | C=CC[C@@]1(O)C(C)c2c(ccc(F)c2Br)C(F)(F)C1(F)F |
| InChI | InChI=1S/C14H12BrF5O/c1-3-6-12(21)7(2)10-8(4-5-9(16)11(10)15)13(17,18)14(12,19)20/h3-5,7,21H,1,6H2,2H3/t7?,12-/m1/s1 |
| InChIKey | LNMTZZWQBGLRKR-RKSKCOGQSA-N |
| XLogP | 4.74 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.14 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|