About 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide
3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide (PubChem CID 156895400) has the molecular formula C7H8F2N2O4
and a molecular weight of 222.15 g/mol. Its IUPAC name is 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide.
Molecular Properties
| Compound Name | 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide |
| PubChem CID | 156895400 |
| Molecular Formula | C7H8F2N2O4 |
| Molecular Weight | 222.15 g/mol |
| Exact Mass | 222.05 |
| IUPAC Name | 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide |
| SMILES | CON(C)C(=O)c1cc(OC(F)F)no1 |
| InChI | InChI=1S/C7H8F2N2O4/c1-11(13-2)6(12)4-3-5(10-15-4)14-7(8)9/h3,7H,1-2H3 |
| InChIKey | LVRTZIQSPPNEBM-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 64.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.15 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
The IUPAC name of 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide (CID 156895400) is 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide.
What is the SMILES notation for 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
The canonical SMILES for 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide is CON(C)C(=O)c1cc(OC(F)F)no1.
What is the InChIKey of 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
The InChIKey is LVRTZIQSPPNEBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8F2N2O4/c1-11(13-2)6(12)4-3-5(10-15-4)14-7(8)9/h3,7H,1-2H3.
What are the key properties of 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide?
3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide has a molecular weight of 222.15 g/mol, XLogP of 0.91, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(difluoromethoxy)-N-methoxy-N-methyl-1,2-oxazole-5-carboxamide is sourced from PubChem (CID 156895400), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).