C18H15F3N2O3 — CID 156895583
acetamide;1-amino-7-(trifluoromethyl)-4b,9b-dihydroindeno[1,2-b][1]benzofuran-10-one (PubChem CID 156895583) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is acetamide;1-amino-7-(trifluoromethyl)-4b,9b-dihydroindeno[1,2-b][1]benzofuran-10-one.
| Compound Name | acetamide;1-amino-7-(trifluoromethyl)-4b,9b-dihydroindeno[1,2-b][1]benzofuran-10-one |
|---|---|
| PubChem CID | 156895583 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | acetamide;1-amino-7-(trifluoromethyl)-4b,9b-dihydroindeno[1,2-b][1]benzofuran-10-one |
| SMILES | CC(N)=O.Nc1cccc2c1C(=O)C1c3ccc(C(F)(F)F)cc3OC21 |
| InChI | InChI=1S/C16H10F3NO2.C2H5NO/c17-16(18,19)7-4-5-8-11(6-7)22-15-9-2-1-3-10(20)12(9)14(21)13(8)15;1-2(3)4/h1-6,13,15H,20H2;1H3,(H2,3,4) |
| InChIKey | MCJWPHXDXYWCHU-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 95.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|