C18H13F3N2O4 — CID 156895589
N-[(4bS,9bS)-1-amino-4b-hydroxy-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide (PubChem CID 156895589) has the molecular formula C18H13F3N2O4 and a molecular weight of 378.31 g/mol. Its IUPAC name is N-[(4bS,9bS)-1-amino-4b-hydroxy-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide.
| Compound Name | N-[(4bS,9bS)-1-amino-4b-hydroxy-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide |
|---|---|
| PubChem CID | 156895589 |
| Molecular Formula | C18H13F3N2O4 |
| Molecular Weight | 378.31 g/mol |
| Exact Mass | 378.08 |
| IUPAC Name | N-[(4bS,9bS)-1-amino-4b-hydroxy-10-oxo-7-(trifluoromethyl)indeno[1,2-b][1]benzofuran-9b-yl]acetamide |
| SMILES | CC(=O)N[C@@]12C(=O)c3c(N)cccc3[C@]1(O)Oc1cc(C(F)(F)F)ccc12 |
| InChI | InChI=1S/C18H13F3N2O4/c1-8(24)23-16-10-6-5-9(18(19,20)21)7-13(10)27-17(16,26)11-3-2-4-12(22)14(11)15(16)25/h2-7,26H,22H2,1H3,(H,23,24)/t16-,17-/m0/s1 |
| InChIKey | OIDCHZNPOLORBR-IRXDYDNUSA-N |
| XLogP | 2.05 |
| TPSA | 101.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.31 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|