C15H17NO3 — CID 156896216
8-cyclopropyloxy-3,6-dimethylquinoline;formic acid (PubChem CID 156896216) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 8-cyclopropyloxy-3,6-dimethylquinoline;formic acid.
| Compound Name | 8-cyclopropyloxy-3,6-dimethylquinoline;formic acid |
|---|---|
| PubChem CID | 156896216 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 8-cyclopropyloxy-3,6-dimethylquinoline;formic acid |
| SMILES | Cc1cnc2c(OC3CC3)cc(C)cc2c1.O=CO |
| InChI | InChI=1S/C14H15NO.CH2O2/c1-9-5-11-6-10(2)8-15-14(11)13(7-9)16-12-3-4-12;2-1-3/h5-8,12H,3-4H2,1-2H3;1H,(H,2,3) |
| InChIKey | HMOHMVUCHAEICM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|