C42H26BN3Rb2 — CID 156896418
CID 156896418 (PubChem CID 156896418) has the molecular formula C42H26BN3Rb2 and a molecular weight of 754.44 g/mol.
| Compound Name | CID 156896418 |
|---|---|
| PubChem CID | 156896418 |
| Molecular Formula | C42H26BN3Rb2 |
| Molecular Weight | 754.44 g/mol |
| Exact Mass | 753.05 |
| IUPAC Name | — |
| SMILES | [Rb+].[Rb+].[c-]1ccc2c(c1)c1c[c-]cc3c1n2B1c2ccccc2N(c2ccccc2)c2cc(N(c4ccccc4)c4ccccc4)cc-3c21 |
| InChI | InChI=1S/C42H26BN3.2Rb/c1-4-15-29(16-5-1)44(30-17-6-2-7-18-30)32-27-36-35-23-14-22-34-33-21-10-12-25-38(33)46(42(34)35)43-37-24-11-13-26-39(37)45(40(28-32)41(36)43)31-19-8-3-9-20-31;;/h1-9,11-13,15-28H;;/q-2;2*+1 |
| InChIKey | VFRBLAQVJISZMP-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 11.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 48 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.44 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|