C30H28N2O2+2 — CID 156896733
2,2-diethyl-3-[2-(1-methylpyridin-1-ium-2-yl)phenyl]-9-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaen-10-one (PubChem CID 156896733) has the molecular formula C30H28N2O2+2 and a molecular weight of 448.57 g/mol. Its IUPAC name is 2,2-diethyl-3-[2-(1-methylpyridin-1-ium-2-yl)phenyl]-9-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaen-10-one.
| Compound Name | 2,2-diethyl-3-[2-(1-methylpyridin-1-ium-2-yl)phenyl]-9-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaen-10-one |
|---|---|
| PubChem CID | 156896733 |
| Molecular Formula | C30H28N2O2+2 |
| Molecular Weight | 448.57 g/mol |
| Exact Mass | 448.21 |
| IUPAC Name | 2,2-diethyl-3-[2-(1-methylpyridin-1-ium-2-yl)phenyl]-9-oxa-1-azoniatetracyclo[6.6.2.04,16.011,15]hexadeca-1(14),4(16),5,7,11(15),12-hexaen-10-one |
| SMILES | CCC1(CC)C(c2ccccc2-c2cccc[n+]2C)c2cccc3oc(=O)c4ccc[n+]1c4c23 |
| InChI | InChI=1S/C30H28N2O2/c1-4-30(5-2)27(21-13-7-6-12-20(21)24-16-8-9-18-31(24)3)22-14-10-17-25-26(22)28-23(29(33)34-25)15-11-19-32(28)30/h6-19,27H,4-5H2,1-3H3/q+2 |
| InChIKey | VXEGQTBYJTZXQK-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 37.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.57 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|