C15H24F6N2O4 — CID 156896870
4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;ethane (PubChem CID 156896870) has the molecular formula C15H24F6N2O4 and a molecular weight of 410.36 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;ethane.
| Compound Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;ethane |
|---|---|
| PubChem CID | 156896870 |
| Molecular Formula | C15H24F6N2O4 |
| Molecular Weight | 410.36 g/mol |
| Exact Mass | 410.16 |
| IUPAC Name | 4-O-tert-butyl 1-O-(1,1,1,3,3,3-hexafluoropropan-2-yl) piperazine-1,4-dicarboxylate;ethane |
| SMILES | CC.CC(C)(C)OC(=O)N1CCN(C(=O)OC(C(F)(F)F)C(F)(F)F)CC1 |
| InChI | InChI=1S/C13H18F6N2O4.C2H6/c1-11(2,3)25-10(23)21-6-4-20(5-7-21)9(22)24-8(12(14,15)16)13(17,18)19;1-2/h8H,4-7H2,1-3H3;1-2H3 |
| InChIKey | IZXAQXROLVOPOB-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 59.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |