C23H44Si — CID 156896873
trimethyl-(1,2,3,4,5-pentapropylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 156896873) has the molecular formula C23H44Si and a molecular weight of 348.69 g/mol. Its IUPAC name is trimethyl-(1,2,3,4,5-pentapropylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | trimethyl-(1,2,3,4,5-pentapropylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 156896873 |
| Molecular Formula | C23H44Si |
| Molecular Weight | 348.69 g/mol |
| Exact Mass | 348.32 |
| IUPAC Name | trimethyl-(1,2,3,4,5-pentapropylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CCCC1=C(CCC)C(CCC)([Si](C)(C)C)C(CCC)=C1CCC |
| InChI | InChI=1S/C23H44Si/c1-9-14-19-20(15-10-2)22(17-12-4)23(18-13-5,24(6,7)8)21(19)16-11-3/h9-18H2,1-8H3 |
| InChIKey | PYIJJQUHSSEUBN-UHFFFAOYSA-N |
| XLogP | 8.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.69 |
| LogP ≤ 5 | 8.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|