C25H33FN4O — CID 156897865
N-(4-fluoro-3-methylphenyl)-3-methyl-5-(5-piperidin-1-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide (PubChem CID 156897865) has the molecular formula C25H33FN4O and a molecular weight of 424.56 g/mol. Its IUPAC name is N-(4-fluoro-3-methylphenyl)-3-methyl-5-(5-piperidin-1-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide.
| Compound Name | N-(4-fluoro-3-methylphenyl)-3-methyl-5-(5-piperidin-1-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide |
|---|---|
| PubChem CID | 156897865 |
| Molecular Formula | C25H33FN4O |
| Molecular Weight | 424.56 g/mol |
| Exact Mass | 424.26 |
| IUPAC Name | N-(4-fluoro-3-methylphenyl)-3-methyl-5-(5-piperidin-1-yl-1,2,3,3a,4,5,6,6a-octahydropentalen-2-yl)imidazole-4-carboxamide |
| SMILES | Cc1cc(NC(=O)c2c(C3CC4CC(N5CCCCC5)CC4C3)ncn2C)ccc1F |
| InChI | InChI=1S/C25H33FN4O/c1-16-10-20(6-7-22(16)26)28-25(31)24-23(27-15-29(24)2)19-11-17-13-21(14-18(17)12-19)30-8-4-3-5-9-30/h6-7,10,15,17-19,21H,3-5,8-9,11-14H2,1-2H3,(H,28,31) |
| InChIKey | VBTFOOBCYRJYML-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.56 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |