C21H15Cl2N7O2S — CID 156898600
2-(1,3-benzoxazol-2-ylamino)-4-(2,5-dichlorophenyl)-6-methyl-N-(1,3,4-thiadiazol-2-yl)-1,4-dihydropyrimidine-5-carboxamide (PubChem CID 156898600) has the molecular formula C21H15Cl2N7O2S and a molecular weight of 500.37 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-ylamino)-4-(2,5-dichlorophenyl)-6-methyl-N-(1,3,4-thiadiazol-2-yl)-1,4-dihydropyrimidine-5-carboxamide.
| Compound Name | 2-(1,3-benzoxazol-2-ylamino)-4-(2,5-dichlorophenyl)-6-methyl-N-(1,3,4-thiadiazol-2-yl)-1,4-dihydropyrimidine-5-carboxamide |
|---|---|
| PubChem CID | 156898600 |
| Molecular Formula | C21H15Cl2N7O2S |
| Molecular Weight | 500.37 g/mol |
| Exact Mass | 499.04 |
| IUPAC Name | 2-(1,3-benzoxazol-2-ylamino)-4-(2,5-dichlorophenyl)-6-methyl-N-(1,3,4-thiadiazol-2-yl)-1,4-dihydropyrimidine-5-carboxamide |
| SMILES | CC1=C(C(=O)Nc2nncs2)C(c2cc(Cl)ccc2Cl)N=C(Nc2nc3ccccc3o2)N1 |
| InChI | InChI=1S/C21H15Cl2N7O2S/c1-10-16(18(31)28-21-30-24-9-33-21)17(12-8-11(22)6-7-13(12)23)27-19(25-10)29-20-26-14-4-2-3-5-15(14)32-20/h2-9,17H,1H3,(H,28,30,31)(H2,25,26,27,29) |
| InChIKey | ANQQQIDNPLRLQZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 117.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.37 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |