C25H30F4N4O — CID 156899289
(3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-5-methyl-2-(oxan-4-ylmethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine (PubChem CID 156899289) has the molecular formula C25H30F4N4O and a molecular weight of 478.53 g/mol. Its IUPAC name is (3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-5-methyl-2-(oxan-4-ylmethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-5-methyl-2-(oxan-4-ylmethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 156899289 |
| Molecular Formula | C25H30F4N4O |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | (3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-5-methyl-2-(oxan-4-ylmethyl)-1,3,3a,4,6,6a-hexahydrocyclopenta[c]pyrrol-5-amine |
| SMILES | CC1(Nc2nnc(-c3cccc(F)c3)cc2C(F)(F)F)C[C@H]2CN(CC3CCOCC3)C[C@H]2C1 |
| InChI | InChI=1S/C25H30F4N4O/c1-24(11-18-14-33(15-19(18)12-24)13-16-5-7-34-8-6-16)30-23-21(25(27,28)29)10-22(31-32-23)17-3-2-4-20(26)9-17/h2-4,9-10,16,18-19H,5-8,11-15H2,1H3,(H,30,32)/t18-,19+,24? |
| InChIKey | HKHSGNQIMYHPBM-QRQCMCJISA-N |
| XLogP | 5.24 |
| TPSA | 50.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |