C24H23F4N5 — CID 156899383
(3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine (PubChem CID 156899383) has the molecular formula C24H23F4N5 and a molecular weight of 457.48 g/mol. Its IUPAC name is (3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine.
| Compound Name | (3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
|---|---|
| PubChem CID | 156899383 |
| Molecular Formula | C24H23F4N5 |
| Molecular Weight | 457.48 g/mol |
| Exact Mass | 457.19 |
| IUPAC Name | (3aR,6aS)-N-[6-(3-fluorophenyl)-4-(trifluoromethyl)pyridazin-3-yl]-2-(pyridin-2-ylmethyl)-3,3a,4,5,6,6a-hexahydro-1H-cyclopenta[c]pyrrol-5-amine |
| SMILES | Fc1cccc(-c2cc(C(F)(F)F)c(NC3C[C@@H]4CN(Cc5ccccn5)C[C@@H]4C3)nn2)c1 |
| InChI | InChI=1S/C24H23F4N5/c25-18-5-3-4-15(8-18)22-11-21(24(26,27)28)23(32-31-22)30-20-9-16-12-33(13-17(16)10-20)14-19-6-1-2-7-29-19/h1-8,11,16-17,20H,9-10,12-14H2,(H,30,32)/t16-,17+,20? |
| InChIKey | AKGILPLJCFALKG-XEWABKELSA-N |
| XLogP | 5.02 |
| TPSA | 53.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.48 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |