C6H6N4O3 — CID 156899737
1,4a,5,8a-tetrahydropteridine-2,4,6-trione (PubChem CID 156899737) has the molecular formula C6H6N4O3 and a molecular weight of 182.14 g/mol. Its IUPAC name is 1,4a,5,8a-tetrahydropteridine-2,4,6-trione.
| Compound Name | 1,4a,5,8a-tetrahydropteridine-2,4,6-trione |
|---|---|
| PubChem CID | 156899737 |
| Molecular Formula | C6H6N4O3 |
| Molecular Weight | 182.14 g/mol |
| Exact Mass | 182.04 |
| IUPAC Name | 1,4a,5,8a-tetrahydropteridine-2,4,6-trione |
| SMILES | O=C1C=NC2NC(=O)NC(=O)C2N1 |
| InChI | InChI=1S/C6H6N4O3/c11-2-1-7-4-3(8-2)5(12)10-6(13)9-4/h1,3-4H,(H,8,11)(H2,9,10,12,13) |
| InChIKey | DPOJHEMHHDNBMA-UHFFFAOYSA-N |
| XLogP | -2.28 |
| TPSA | 99.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.14 |
| LogP ≤ 5 | -2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |