C23H30N8O4 — CID 156900175
[5-[5-[(1S,3S)-3-(2-diazoacetyl)cyclopentyl]oxy-6-methylpyrazin-2-yl]-3-methyltriazol-4-yl]methyl N-(cyclobutylmethyl)-N-methylcarbamate (PubChem CID 156900175) has the molecular formula C23H30N8O4 and a molecular weight of 482.55 g/mol. Its IUPAC name is [5-[5-[(1S,3S)-3-(2-diazoacetyl)cyclopentyl]oxy-6-methylpyrazin-2-yl]-3-methyltriazol-4-yl]methyl N-(cyclobutylmethyl)-N-methylcarbamate.
| Compound Name | [5-[5-[(1S,3S)-3-(2-diazoacetyl)cyclopentyl]oxy-6-methylpyrazin-2-yl]-3-methyltriazol-4-yl]methyl N-(cyclobutylmethyl)-N-methylcarbamate |
|---|---|
| PubChem CID | 156900175 |
| Molecular Formula | C23H30N8O4 |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.24 |
| IUPAC Name | [5-[5-[(1S,3S)-3-(2-diazoacetyl)cyclopentyl]oxy-6-methylpyrazin-2-yl]-3-methyltriazol-4-yl]methyl N-(cyclobutylmethyl)-N-methylcarbamate |
| SMILES | Cc1nc(-c2nnn(C)c2COC(=O)N(C)CC2CCC2)cnc1O[C@H]1CC[C@H](C(=O)C=[N+]=[N-])C1 |
| InChI | InChI=1S/C23H30N8O4/c1-14-22(35-17-8-7-16(9-17)20(32)11-26-24)25-10-18(27-14)21-19(31(3)29-28-21)13-34-23(33)30(2)12-15-5-4-6-15/h10-11,15-17H,4-9,12-13H2,1-3H3/t16-,17-/m0/s1 |
| InChIKey | WDUPBTBKKZTWHH-IRXDYDNUSA-N |
| XLogP | 2.37 |
| TPSA | 148.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|