C30H33N5O2 — CID 156900222
6-[N-methyl-4-[[3-methyl-4-(2-pyrazin-2-ylethynyl)phenyl]diazenyl]anilino]hexyl 2-methylprop-2-enoate (PubChem CID 156900222) has the molecular formula C30H33N5O2 and a molecular weight of 495.63 g/mol. Its IUPAC name is 6-[N-methyl-4-[[3-methyl-4-(2-pyrazin-2-ylethynyl)phenyl]diazenyl]anilino]hexyl 2-methylprop-2-enoate.
| Compound Name | 6-[N-methyl-4-[[3-methyl-4-(2-pyrazin-2-ylethynyl)phenyl]diazenyl]anilino]hexyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 156900222 |
| Molecular Formula | C30H33N5O2 |
| Molecular Weight | 495.63 g/mol |
| Exact Mass | 495.26 |
| IUPAC Name | 6-[N-methyl-4-[[3-methyl-4-(2-pyrazin-2-ylethynyl)phenyl]diazenyl]anilino]hexyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCN(C)c1ccc(/N=N/c2ccc(C#Cc3cnccn3)c(C)c2)cc1 |
| InChI | InChI=1S/C30H33N5O2/c1-23(2)30(36)37-20-8-6-5-7-19-35(4)29-15-13-26(14-16-29)33-34-27-11-9-25(24(3)21-27)10-12-28-22-31-17-18-32-28/h9,11,13-18,21-22H,1,5-8,19-20H2,2-4H3/b34-33+ |
| InChIKey | VRKZSIVXRMXABH-JEIPZWNWSA-N |
| XLogP | 6.72 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.63 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|