About 4,4-difluoro-3H-pyridine;hydrochloride
4,4-difluoro-3H-pyridine;hydrochloride (PubChem CID 156900243) has the molecular formula C5H6ClF2N
and a molecular weight of 153.56 g/mol. Its IUPAC name is 4,4-difluoro-3H-pyridine;hydrochloride.
Molecular Properties
| Compound Name | 4,4-difluoro-3H-pyridine;hydrochloride |
| PubChem CID | 156900243 |
| Molecular Formula | C5H6ClF2N |
| Molecular Weight | 153.56 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 4,4-difluoro-3H-pyridine;hydrochloride |
| SMILES | Cl.FC1(F)C=CN=CC1 |
| InChI | InChI=1S/C5H5F2N.ClH/c6-5(7)1-3-8-4-2-5;/h1,3-4H,2H2;1H |
| InChIKey | LSAYLMWKFNLNKD-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.56 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4,4-difluoro-3H-pyridine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,4-difluoro-3H-pyridine;hydrochloride?
The IUPAC name of 4,4-difluoro-3H-pyridine;hydrochloride (CID 156900243) is 4,4-difluoro-3H-pyridine;hydrochloride.
What is the SMILES notation for 4,4-difluoro-3H-pyridine;hydrochloride?
The canonical SMILES for 4,4-difluoro-3H-pyridine;hydrochloride is Cl.FC1(F)C=CN=CC1.
What is the InChIKey of 4,4-difluoro-3H-pyridine;hydrochloride?
The InChIKey is LSAYLMWKFNLNKD-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H5F2N.ClH/c6-5(7)1-3-8-4-2-5;/h1,3-4H,2H2;1H.
What are the key properties of 4,4-difluoro-3H-pyridine;hydrochloride?
4,4-difluoro-3H-pyridine;hydrochloride has a molecular weight of 153.56 g/mol, XLogP of 2.03, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4,4-difluoro-3H-pyridine;hydrochloride is sourced from PubChem (CID 156900243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).