About 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine
5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine (PubChem CID 156900796) has the molecular formula C9H10N2O3S
and a molecular weight of 226.26 g/mol. Its IUPAC name is 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine.
Molecular Properties
| Compound Name | 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine |
| PubChem CID | 156900796 |
| Molecular Formula | C9H10N2O3S |
| Molecular Weight | 226.26 g/mol |
| Exact Mass | 226.04 |
| IUPAC Name | 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine |
| SMILES | C/N=C1\NS(=O)(=O)c2ccc(OC)cc21 |
| InChI | InChI=1S/C9H10N2O3S/c1-10-9-7-5-6(14-2)3-4-8(7)15(12,13)11-9/h3-5H,1-2H3,(H,10,11) |
| InChIKey | SQOCRANNGCZHJL-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.26 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine?
The IUPAC name of 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine (CID 156900796) is 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine.
What is the SMILES notation for 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine?
The canonical SMILES for 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine is C/N=C1\NS(=O)(=O)c2ccc(OC)cc21.
What is the InChIKey of 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine?
The InChIKey is SQOCRANNGCZHJL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O3S/c1-10-9-7-5-6(14-2)3-4-8(7)15(12,13)11-9/h3-5H,1-2H3,(H,10,11).
What are the key properties of 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine?
5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine has a molecular weight of 226.26 g/mol, XLogP of 0.36, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-N-methyl-1,1-dioxo-1,2-benzothiazol-3-imine is sourced from PubChem (CID 156900796), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).