C32H44N6O12 — CID 156901204
tert-butyl 4-[[2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate (PubChem CID 156901204) has the molecular formula C32H44N6O12 and a molecular weight of 704.73 g/mol. Its IUPAC name is tert-butyl 4-[[2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate.
| Compound Name | tert-butyl 4-[[2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate |
|---|---|
| PubChem CID | 156901204 |
| Molecular Formula | C32H44N6O12 |
| Molecular Weight | 704.73 g/mol |
| Exact Mass | 704.30 |
| IUPAC Name | tert-butyl 4-[[2,3-bis[[2-(2,5-dioxopyrrol-1-yl)acetyl]amino]-4-[[4-[(2-methylpropan-2-yl)oxy]-4-oxobutyl]amino]-4-oxobutanoyl]amino]butanoate |
| SMILES | CC(C)(C)OC(=O)CCCNC(=O)C(NC(=O)CN1C(=O)C=CC1=O)C(NC(=O)CN1C(=O)C=CC1=O)C(=O)NCCCC(=O)OC(C)(C)C |
| InChI | InChI=1S/C32H44N6O12/c1-31(2,3)49-25(45)9-7-15-33-29(47)27(35-19(39)17-37-21(41)11-12-22(37)42)28(36-20(40)18-38-23(43)13-14-24(38)44)30(48)34-16-8-10-26(46)50-32(4,5)6/h11-14,27-28H,7-10,15-18H2,1-6H3,(H,33,47)(H,34,48)(H,35,39)(H,36,40) |
| InChIKey | QNWKWYLLSLOOCV-UHFFFAOYSA-N |
| XLogP | -1.72 |
| TPSA | 243.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 704.73 |
| LogP ≤ 5 | -1.72 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|