C23H30N6O6 — CID 15690122
ethyl 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoate (PubChem CID 15690122) has the molecular formula C23H30N6O6 and a molecular weight of 486.53 g/mol. Its IUPAC name is ethyl 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoate.
| Compound Name | ethyl 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoate |
|---|---|
| PubChem CID | 15690122 |
| Molecular Formula | C23H30N6O6 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.22 |
| IUPAC Name | ethyl 3-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]propanoate |
| SMILES | CCOC(=O)CCc1ccc(CCNc2nc(N)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)cc1 |
| InChI | InChI=1S/C23H30N6O6/c1-2-34-16(31)8-7-13-3-5-14(6-4-13)9-10-25-23-27-20(24)17-21(28-23)29(12-26-17)22-19(33)18(32)15(11-30)35-22/h3-6,12,15,18-19,22,30,32-33H,2,7-11H2,1H3,(H3,24,25,27,28)/t15-,18-,19-,22-/m1/s1 |
| InChIKey | UDTMUBXFDYMWKX-CIVUBGFFSA-N |
| XLogP | 0.17 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |