About 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride
1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride (PubChem CID 156901234) has the molecular formula C14H19Cl2N3
and a molecular weight of 300.23 g/mol. Its IUPAC name is 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride.
Molecular Properties
| Compound Name | 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride |
| PubChem CID | 156901234 |
| Molecular Formula | C14H19Cl2N3 |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride |
| SMILES | Cl.Cl.N#Cc1ccc2c(c1)CC1(CCN(N)CC1)C2 |
| InChI | InChI=1S/C14H17N3.2ClH/c15-10-11-1-2-12-8-14(9-13(12)7-11)3-5-17(16)6-4-14;;/h1-2,7H,3-6,8-9,16H2;2*1H |
| InChIKey | QEZOXJQCWFLTDQ-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 53.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|
Analyze 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride?
The IUPAC name of 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride (CID 156901234) is 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride.
What is the SMILES notation for 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride?
The canonical SMILES for 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride is Cl.Cl.N#Cc1ccc2c(c1)CC1(CCN(N)CC1)C2.
What is the InChIKey of 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride?
The InChIKey is QEZOXJQCWFLTDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H17N3.2ClH/c15-10-11-1-2-12-8-14(9-13(12)7-11)3-5-17(16)6-4-14;;/h1-2,7H,3-6,8-9,16H2;2*1H.
What are the key properties of 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride?
1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride has a molecular weight of 300.23 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1'-aminospiro[1,3-dihydroindene-2,4'-piperidine]-5-carbonitrile;dihydrochloride is sourced from PubChem (CID 156901234), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).