C22H28N6O6 — CID 15690131
ethyl 2-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]acetate (PubChem CID 15690131) has the molecular formula C22H28N6O6 and a molecular weight of 472.50 g/mol. Its IUPAC name is ethyl 2-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]acetate.
| Compound Name | ethyl 2-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]acetate |
|---|---|
| PubChem CID | 15690131 |
| Molecular Formula | C22H28N6O6 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.21 |
| IUPAC Name | ethyl 2-[4-[2-[[6-amino-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]purin-2-yl]amino]ethyl]phenyl]acetate |
| SMILES | CCOC(=O)Cc1ccc(CCNc2nc(N)c3ncn([C@@H]4O[C@H](CO)[C@@H](O)[C@H]4O)c3n2)cc1 |
| InChI | InChI=1S/C22H28N6O6/c1-2-33-15(30)9-13-5-3-12(4-6-13)7-8-24-22-26-19(23)16-20(27-22)28(11-25-16)21-18(32)17(31)14(10-29)34-21/h3-6,11,14,17-18,21,29,31-32H,2,7-10H2,1H3,(H3,23,24,26,27)/t14-,17-,18-,21-/m1/s1 |
| InChIKey | LGZFNHNHZLUIIO-HAXDFEGKSA-N |
| XLogP | -0.22 |
| TPSA | 177.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.50 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |