C22H15BN2O2S — CID 156901757
[4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]boronic acid (PubChem CID 156901757) has the molecular formula C22H15BN2O2S and a molecular weight of 382.25 g/mol. Its IUPAC name is [4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]boronic acid.
| Compound Name | [4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]boronic acid |
|---|---|
| PubChem CID | 156901757 |
| Molecular Formula | C22H15BN2O2S |
| Molecular Weight | 382.25 g/mol |
| Exact Mass | 382.09 |
| IUPAC Name | [4-(4-phenyl-[1]benzothiolo[3,2-d]pyrimidin-2-yl)phenyl]boronic acid |
| SMILES | OB(O)c1ccc(-c2nc(-c3ccccc3)c3sc4ccccc4c3n2)cc1 |
| InChI | InChI=1S/C22H15BN2O2S/c26-23(27)16-12-10-15(11-13-16)22-24-19(14-6-2-1-3-7-14)21-20(25-22)17-8-4-5-9-18(17)28-21/h1-13,26-27H |
| InChIKey | RYBGHRHLNGJEKW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.25 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|