C17H17ClF3N3O4S — CID 156902038
2-chloroethyl N-[3-[3-(methylcarbamoyl)-7-(trifluoromethyl)thieno[3,2-b]pyridin-5-yl]oxycyclobutyl]carbamate (PubChem CID 156902038) has the molecular formula C17H17ClF3N3O4S and a molecular weight of 451.85 g/mol. Its IUPAC name is 2-chloroethyl N-[3-[3-(methylcarbamoyl)-7-(trifluoromethyl)thieno[3,2-b]pyridin-5-yl]oxycyclobutyl]carbamate.
| Compound Name | 2-chloroethyl N-[3-[3-(methylcarbamoyl)-7-(trifluoromethyl)thieno[3,2-b]pyridin-5-yl]oxycyclobutyl]carbamate |
|---|---|
| PubChem CID | 156902038 |
| Molecular Formula | C17H17ClF3N3O4S |
| Molecular Weight | 451.85 g/mol |
| Exact Mass | 451.06 |
| IUPAC Name | 2-chloroethyl N-[3-[3-(methylcarbamoyl)-7-(trifluoromethyl)thieno[3,2-b]pyridin-5-yl]oxycyclobutyl]carbamate |
| SMILES | CNC(=O)c1csc2c(C(F)(F)F)cc(OC3CC(NC(=O)OCCCl)C3)nc12 |
| InChI | InChI=1S/C17H17ClF3N3O4S/c1-22-15(25)10-7-29-14-11(17(19,20)21)6-12(24-13(10)14)28-9-4-8(5-9)23-16(26)27-3-2-18/h6-9H,2-5H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | NYYNWGUAZUTWAK-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 89.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.85 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|