About 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine
1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine (PubChem CID 156902189) has the molecular formula C14H16F2N2OS
and a molecular weight of 298.36 g/mol. Its IUPAC name is 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine |
| PubChem CID | 156902189 |
| Molecular Formula | C14H16F2N2OS |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine |
| SMILES | COCc1cc(-c2ccc(C(N)CN)c(F)c2F)cs1 |
| InChI | InChI=1S/C14H16F2N2OS/c1-19-6-9-4-8(7-20-9)10-2-3-11(12(18)5-17)14(16)13(10)15/h2-4,7,12H,5-6,17-18H2,1H3 |
| InChIKey | DKVHJXFKQXOUBJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 61.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine?
The IUPAC name of 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine (CID 156902189) is 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine.
What is the SMILES notation for 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine?
The canonical SMILES for 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine is COCc1cc(-c2ccc(C(N)CN)c(F)c2F)cs1.
What is the InChIKey of 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine?
The InChIKey is DKVHJXFKQXOUBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16F2N2OS/c1-19-6-9-4-8(7-20-9)10-2-3-11(12(18)5-17)14(16)13(10)15/h2-4,7,12H,5-6,17-18H2,1H3.
What are the key properties of 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine?
1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine has a molecular weight of 298.36 g/mol, XLogP of 2.80, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2,3-difluoro-4-[5-(methoxymethyl)thiophen-3-yl]phenyl]ethane-1,2-diamine is sourced from PubChem (CID 156902189), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).