C34H37N3 — CID 156902451
3-[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl]-2-methylbenzonitrile (PubChem CID 156902451) has the molecular formula C34H37N3 and a molecular weight of 487.69 g/mol. Its IUPAC name is 3-[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl]-2-methylbenzonitrile.
| Compound Name | 3-[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl]-2-methylbenzonitrile |
|---|---|
| PubChem CID | 156902451 |
| Molecular Formula | C34H37N3 |
| Molecular Weight | 487.69 g/mol |
| Exact Mass | 487.30 |
| IUPAC Name | 3-[5,6-bis(3-tert-butyl-5-methylphenyl)pyrazin-2-yl]-2-methylbenzonitrile |
| SMILES | Cc1cc(-c2ncc(-c3cccc(C#N)c3C)nc2-c2cc(C)cc(C(C)(C)C)c2)cc(C(C)(C)C)c1 |
| InChI | InChI=1S/C34H37N3/c1-21-13-25(17-27(15-21)33(4,5)6)31-32(26-14-22(2)16-28(18-26)34(7,8)9)37-30(20-36-31)29-12-10-11-24(19-35)23(29)3/h10-18,20H,1-9H3 |
| InChIKey | SUBGBTFVVULYQY-UHFFFAOYSA-N |
| XLogP | 8.87 |
| TPSA | 49.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.69 |
| LogP ≤ 5 | 8.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |