C32H26N4O2 — CID 156902546
N-[3-[(2-dibenzofuran-4-yl-4-pyridinyl)amino]phenyl]-4-(dimethylamino)benzamide (PubChem CID 156902546) has the molecular formula C32H26N4O2 and a molecular weight of 498.59 g/mol. Its IUPAC name is N-[3-[(2-dibenzofuran-4-yl-4-pyridinyl)amino]phenyl]-4-(dimethylamino)benzamide.
| Compound Name | N-[3-[(2-dibenzofuran-4-yl-4-pyridinyl)amino]phenyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 156902546 |
| Molecular Formula | C32H26N4O2 |
| Molecular Weight | 498.59 g/mol |
| Exact Mass | 498.21 |
| IUPAC Name | N-[3-[(2-dibenzofuran-4-yl-4-pyridinyl)amino]phenyl]-4-(dimethylamino)benzamide |
| SMILES | CN(C)c1ccc(C(=O)Nc2cccc(Nc3ccnc(-c4cccc5c4oc4ccccc45)c3)c2)cc1 |
| InChI | InChI=1S/C32H26N4O2/c1-36(2)25-15-13-21(14-16-25)32(37)35-23-8-5-7-22(19-23)34-24-17-18-33-29(20-24)28-11-6-10-27-26-9-3-4-12-30(26)38-31(27)28/h3-20H,1-2H3,(H,33,34)(H,35,37) |
| InChIKey | YYUCUZSVXPGBGX-UHFFFAOYSA-N |
| XLogP | 7.71 |
| TPSA | 70.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.59 |
| LogP ≤ 5 | 7.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |