C28H28F2N6O3 — CID 156902756
cyclopropyl-[(2S)-2-[5-[(2,4-dimethoxyphenyl)methylamino]-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]-4,4-difluoropyrrolidin-1-yl]methanone (PubChem CID 156902756) has the molecular formula C28H28F2N6O3 and a molecular weight of 534.57 g/mol. Its IUPAC name is cyclopropyl-[(2S)-2-[5-[(2,4-dimethoxyphenyl)methylamino]-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]-4,4-difluoropyrrolidin-1-yl]methanone.
| Compound Name | cyclopropyl-[(2S)-2-[5-[(2,4-dimethoxyphenyl)methylamino]-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]-4,4-difluoropyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 156902756 |
| Molecular Formula | C28H28F2N6O3 |
| Molecular Weight | 534.57 g/mol |
| Exact Mass | 534.22 |
| IUPAC Name | cyclopropyl-[(2S)-2-[5-[(2,4-dimethoxyphenyl)methylamino]-7-phenyl-[1,2,4]triazolo[1,5-c]pyrimidin-2-yl]-4,4-difluoropyrrolidin-1-yl]methanone |
| SMILES | COc1ccc(CNc2nc(-c3ccccc3)cc3nc([C@@H]4CC(F)(F)CN4C(=O)C4CC4)nn23)c(OC)c1 |
| InChI | InChI=1S/C28H28F2N6O3/c1-38-20-11-10-19(23(12-20)39-2)15-31-27-32-21(17-6-4-3-5-7-17)13-24-33-25(34-36(24)27)22-14-28(29,30)16-35(22)26(37)18-8-9-18/h3-7,10-13,18,22H,8-9,14-16H2,1-2H3,(H,31,32)/t22-/m0/s1 |
| InChIKey | DGZWISYIMRSIKQ-QFIPXVFZSA-N |
| XLogP | 4.74 |
| TPSA | 93.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.57 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |