C30H32F2N8O2 — CID 156902759
6-(2,5-difluorophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine (PubChem CID 156902759) has the molecular formula C30H32F2N8O2 and a molecular weight of 574.64 g/mol. Its IUPAC name is 6-(2,5-difluorophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine.
| Compound Name | 6-(2,5-difluorophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 156902759 |
| Molecular Formula | C30H32F2N8O2 |
| Molecular Weight | 574.64 g/mol |
| Exact Mass | 574.26 |
| IUPAC Name | 6-(2,5-difluorophenyl)-N-[(2,4-dimethoxyphenyl)methyl]-5-methyl-2-[1-(1-methylpyrazol-4-yl)piperidin-3-yl]-[1,2,4]triazolo[1,5-a]pyrazin-8-amine |
| SMILES | COc1ccc(CNc2nc(-c3cc(F)ccc3F)c(C)n3nc(C4CCCN(c5cnn(C)c5)C4)nc23)c(OC)c1 |
| InChI | InChI=1S/C30H32F2N8O2/c1-18-27(24-12-21(31)8-10-25(24)32)35-29(33-14-19-7-9-23(41-3)13-26(19)42-4)30-36-28(37-40(18)30)20-6-5-11-39(16-20)22-15-34-38(2)17-22/h7-10,12-13,15,17,20H,5-6,11,14,16H2,1-4H3,(H,33,35) |
| InChIKey | LHSKXKZFLOWKKC-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 94.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.64 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |