C13H23N3O5S2 — CID 156903007
1,3-bis[3-(2-hydroxyethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione (PubChem CID 156903007) has the molecular formula C13H23N3O5S2 and a molecular weight of 365.48 g/mol. Its IUPAC name is 1,3-bis[3-(2-hydroxyethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1,3-bis[3-(2-hydroxyethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 156903007 |
| Molecular Formula | C13H23N3O5S2 |
| Molecular Weight | 365.48 g/mol |
| Exact Mass | 365.11 |
| IUPAC Name | 1,3-bis[3-(2-hydroxyethylsulfanyl)propyl]-1,3,5-triazinane-2,4,6-trione |
| SMILES | O=c1[nH]c(=O)n(CCCSCCO)c(=O)n1CCCSCCO |
| InChI | InChI=1S/C13H23N3O5S2/c17-5-9-22-7-1-3-15-11(19)14-12(20)16(13(15)21)4-2-8-23-10-6-18/h17-18H,1-10H2,(H,14,19,20) |
| InChIKey | DZQSBQSSUAZCLO-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 117.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.48 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|