C32H22N4 — CID 156903762
4,6-bis(N-phenylanilino)benzene-1,3-dicarbonitrile (PubChem CID 156903762) has the molecular formula C32H22N4 and a molecular weight of 462.56 g/mol. Its IUPAC name is 4,6-bis(N-phenylanilino)benzene-1,3-dicarbonitrile.
| Compound Name | 4,6-bis(N-phenylanilino)benzene-1,3-dicarbonitrile |
|---|---|
| PubChem CID | 156903762 |
| Molecular Formula | C32H22N4 |
| Molecular Weight | 462.56 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | 4,6-bis(N-phenylanilino)benzene-1,3-dicarbonitrile |
| SMILES | N#Cc1cc(C#N)c(N(c2ccccc2)c2ccccc2)cc1N(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C32H22N4/c33-23-25-21-26(24-34)32(36(29-17-9-3-10-18-29)30-19-11-4-12-20-30)22-31(25)35(27-13-5-1-6-14-27)28-15-7-2-8-16-28/h1-22H |
| InChIKey | UKLFDLDPFDTYHS-UHFFFAOYSA-N |
| XLogP | 8.37 |
| TPSA | 54.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.56 |
| LogP ≤ 5 | 8.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |