C12H18N2O7 — CID 15690390
(1R,2S,3S,9R)-1,2,3,9-tetrahydroxy-3-methyl-8-methylidene-5-oxa-10,12-diazabicyclo[7.2.2]tridecane-11,13-dione (PubChem CID 15690390) has the molecular formula C12H18N2O7 and a molecular weight of 302.28 g/mol. Its IUPAC name is (1R,2S,3S,9R)-1,2,3,9-tetrahydroxy-3-methyl-8-methylidene-5-oxa-10,12-diazabicyclo[7.2.2]tridecane-11,13-dione.
| Compound Name | (1R,2S,3S,9R)-1,2,3,9-tetrahydroxy-3-methyl-8-methylidene-5-oxa-10,12-diazabicyclo[7.2.2]tridecane-11,13-dione |
|---|---|
| PubChem CID | 15690390 |
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | (1R,2S,3S,9R)-1,2,3,9-tetrahydroxy-3-methyl-8-methylidene-5-oxa-10,12-diazabicyclo[7.2.2]tridecane-11,13-dione |
| SMILES | C=C1CCOC[C@](C)(O)[C@H](O)[C@]2(O)NC(=O)[C@@]1(O)NC2=O |
| InChI | InChI=1S/C12H18N2O7/c1-6-3-4-21-5-10(2,18)7(15)12(20)9(17)13-11(6,19)8(16)14-12/h7,15,18-20H,1,3-5H2,2H3,(H,13,17)(H,14,16)/t7-,10-,11+,12+/m0/s1 |
| InChIKey | FJPOGOHBQIFCAT-CWPPHPDTSA-N |
| XLogP | -3.30 |
| TPSA | 148.35 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -3.30 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|