About ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate (PubChem CID 156904132) has the molecular formula C13H25F3O3Si
and a molecular weight of 314.42 g/mol. Its IUPAC name is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate.
Molecular Properties
| Compound Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate |
| PubChem CID | 156904132 |
| Molecular Formula | C13H25F3O3Si |
| Molecular Weight | 314.42 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate |
| SMILES | CCOC(=O)CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F |
| InChI | InChI=1S/C13H25F3O3Si/c1-7-18-11(17)9-8-10(13(14,15)16)19-20(5,6)12(2,3)4/h10H,7-9H2,1-6H3 |
| InChIKey | NMKLMDTUKFXIJK-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.42 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate?
The IUPAC name of ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate (CID 156904132) is ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate.
What is the SMILES notation for ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate?
The canonical SMILES for ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate is CCOC(=O)CCC(O[Si](C)(C)C(C)(C)C)C(F)(F)F.
What is the InChIKey of ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate?
The InChIKey is NMKLMDTUKFXIJK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25F3O3Si/c1-7-18-11(17)9-8-10(13(14,15)16)19-20(5,6)12(2,3)4/h10H,7-9H2,1-6H3.
What are the key properties of ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate?
ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate has a molecular weight of 314.42 g/mol, XLogP of 4.28, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 4-[tert-butyl(dimethyl)silyl]oxy-5,5,5-trifluoropentanoate is sourced from PubChem (CID 156904132), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).