C25H29NO4 — CID 156904452
N-cyclopropyl-3-[4-[3-(2-hydroxyethoxy)cyclopentanecarbonyl]phenyl]-4-methylbenzamide (PubChem CID 156904452) has the molecular formula C25H29NO4 and a molecular weight of 407.51 g/mol. Its IUPAC name is N-cyclopropyl-3-[4-[3-(2-hydroxyethoxy)cyclopentanecarbonyl]phenyl]-4-methylbenzamide.
| Compound Name | N-cyclopropyl-3-[4-[3-(2-hydroxyethoxy)cyclopentanecarbonyl]phenyl]-4-methylbenzamide |
|---|---|
| PubChem CID | 156904452 |
| Molecular Formula | C25H29NO4 |
| Molecular Weight | 407.51 g/mol |
| Exact Mass | 407.21 |
| IUPAC Name | N-cyclopropyl-3-[4-[3-(2-hydroxyethoxy)cyclopentanecarbonyl]phenyl]-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NC2CC2)cc1-c1ccc(C(=O)C2CCC(OCCO)C2)cc1 |
| InChI | InChI=1S/C25H29NO4/c1-16-2-3-20(25(29)26-21-9-10-21)15-23(16)17-4-6-18(7-5-17)24(28)19-8-11-22(14-19)30-13-12-27/h2-7,15,19,21-22,27H,8-14H2,1H3,(H,26,29) |
| InChIKey | SEYIMDBLSWOHEU-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.51 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |